C26H23ClF3N5O3 — CID 74539594
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(E)-cyclopentylmethylideneamino]pyridine-2-carboxamide (PubChem CID 74539594) has the molecular formula C26H23ClF3N5O3 and a molecular weight of 545.95 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(E)-cyclopentylmethylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(E)-cyclopentylmethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 74539594 |
| Molecular Formula | C26H23ClF3N5O3 |
| Molecular Weight | 545.95 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(E)-cyclopentylmethylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc(C(=O)N/N=C/C3CCCC3)c2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H23ClF3N5O3/c27-22-10-7-18(13-21(22)26(28,29)30)34-25(37)33-17-5-8-19(9-6-17)38-20-11-12-31-23(14-20)24(36)35-32-15-16-3-1-2-4-16/h5-16H,1-4H2,(H,35,36)(H2,33,34,37)/b32-15+ |
| InChIKey | QQNWEVFYKUFPPL-VWJSQJICSA-N |
| XLogP | 7.10 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.95 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|