C27H19ClF3N5O4 — CID 141350535
4-[4-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide (PubChem CID 141350535) has the molecular formula C27H19ClF3N5O4 and a molecular weight of 569.93 g/mol. Its IUPAC name is 4-[4-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-[4-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 141350535 |
| Molecular Formula | C27H19ClF3N5O4 |
| Molecular Weight | 569.93 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | 4-[4-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[(4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc(C(=O)NN=Cc3ccc(O)cc3)c2)cc1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C27H19ClF3N5O4/c28-22-10-3-17(27(29,30)31)13-23(22)35-26(39)34-18-4-8-20(9-5-18)40-21-11-12-32-24(14-21)25(38)36-33-15-16-1-6-19(37)7-2-16/h1-15,37H,(H,36,38)(H2,34,35,39) |
| InChIKey | FSUOMIJDIXSVDX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.93 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|