C29H21ClF3N5O4 — CID 87057183
1-[4-[[2-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 87057183) has the molecular formula C29H21ClF3N5O4 and a molecular weight of 595.97 g/mol. Its IUPAC name is 1-[4-[[2-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[[2-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87057183 |
| Molecular Formula | C29H21ClF3N5O4 |
| Molecular Weight | 595.97 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | 1-[4-[[2-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(C(F)(F)F)cc3)cc2)ccn1 |
| InChI | InChI=1S/C29H21ClF3N5O4/c30-20-6-1-18(2-7-20)3-14-26(39)37-38-27(40)25-17-24(15-16-34-25)42-23-12-10-22(11-13-23)36-28(41)35-21-8-4-19(5-9-21)29(31,32)33/h1-17H,(H,37,39)(H,38,40)(H2,35,36,41)/b14-3+ |
| InChIKey | XVEAASKFQBWKQQ-LZWSPWQCSA-N |
| XLogP | 6.66 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.97 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|