C23H18F3N3O3 — CID 130248768
N-methyl-4-[4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenoxy]pyridine-2-carboxamide (PubChem CID 130248768) has the molecular formula C23H18F3N3O3 and a molecular weight of 441.41 g/mol. Its IUPAC name is N-methyl-4-[4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130248768 |
| Molecular Formula | C23H18F3N3O3 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-methyl-4-[4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)/C=C/c3cccc(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C23H18F3N3O3/c1-27-22(31)20-14-19(11-12-28-20)32-18-8-6-17(7-9-18)29-21(30)10-5-15-3-2-4-16(13-15)23(24,25)26/h2-14H,1H3,(H,27,31)(H,29,30)/b10-5+ |
| InChIKey | KJRNOVAAOTXWGY-BJMVGYQFSA-N |
| XLogP | 4.90 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|