C25H23F3N4O3 — CID 11720013
4-[3-[(E)-3-[3-(2-aminoethyl)-5-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 11720013) has the molecular formula C25H23F3N4O3 and a molecular weight of 484.48 g/mol. Its IUPAC name is 4-[3-[(E)-3-[3-(2-aminoethyl)-5-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[(E)-3-[3-(2-aminoethyl)-5-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 11720013 |
| Molecular Formula | C25H23F3N4O3 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 4-[3-[(E)-3-[3-(2-aminoethyl)-5-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(/C=C/C(=O)Nc3cc(CCN)cc(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C25H23F3N4O3/c1-30-24(34)22-15-21(8-10-31-22)35-20-4-2-3-16(13-20)5-6-23(33)32-19-12-17(7-9-29)11-18(14-19)25(26,27)28/h2-6,8,10-15H,7,9,29H2,1H3,(H,30,34)(H,32,33)/b6-5+ |
| InChIKey | ZBQFAFYPRMJWJQ-AATRIKPKSA-N |
| XLogP | 4.41 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|