C21H18F3N5O3 — CID 11476310
N-methyl-4-[3-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]pyridine-2-carboxamide (PubChem CID 11476310) has the molecular formula C21H18F3N5O3 and a molecular weight of 445.40 g/mol. Its IUPAC name is N-methyl-4-[3-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[3-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11476310 |
| Molecular Formula | C21H18F3N5O3 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-methyl-4-[3-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(NNC(=O)Nc3ccc(C(F)(F)F)cc3)c2)ccn1 |
| InChI | InChI=1S/C21H18F3N5O3/c1-25-19(30)18-12-17(9-10-26-18)32-16-4-2-3-15(11-16)28-29-20(31)27-14-7-5-13(6-8-14)21(22,23)24/h2-12,28H,1H3,(H,25,30)(H2,27,29,31) |
| InChIKey | DIKLVHZOWLJECF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|