C21H17ClF3N5O3 — CID 11306141
4-[3-[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 11306141) has the molecular formula C21H17ClF3N5O3 and a molecular weight of 479.85 g/mol. Its IUPAC name is 4-[3-[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 11306141 |
| Molecular Formula | C21H17ClF3N5O3 |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 4-[3-[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(NNC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C21H17ClF3N5O3/c1-26-19(31)18-11-15(7-8-27-18)33-14-4-2-3-13(9-14)29-30-20(32)28-12-5-6-17(22)16(10-12)21(23,24)25/h2-11,29H,1H3,(H,26,31)(H2,28,30,32) |
| InChIKey | GDQREDKNBXRKND-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|