C31H24ClF3N4O9S2 — CID 53258874
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide;naphthalene-1,5-disulfonic acid (PubChem CID 53258874) has the molecular formula C31H24ClF3N4O9S2 and a molecular weight of 753.13 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide;naphthalene-1,5-disulfonic acid.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide;naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 53258874 |
| Molecular Formula | C31H24ClF3N4O9S2 |
| Molecular Weight | 753.13 g/mol |
| Exact Mass | 752.06 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide;naphthalene-1,5-disulfonic acid |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C21H16ClF3N4O3.C10H8O6S2/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h2-11H,1H3,(H,26,30)(H2,28,29,31);1-6H,(H,11,12,13)(H,14,15,16) |
| InChIKey | XSAAVCNTYKHVMH-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 201.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.13 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|