C23H19ClF3N4O5+ — CID 142886765
[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-2-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]acetyl]oxidanium (PubChem CID 142886765) has the molecular formula C23H19ClF3N4O5+ and a molecular weight of 523.88 g/mol. Its IUPAC name is [2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-2-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]acetyl]oxidanium.
| Compound Name | [2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-2-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]acetyl]oxidanium |
|---|---|
| PubChem CID | 142886765 |
| Molecular Formula | C23H19ClF3N4O5+ |
| Molecular Weight | 523.88 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | [2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-2-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]acetyl]oxidanium |
| SMILES | CNC(=O)c1cc(Oc2ccc(C(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)C(=O)[OH2+])cc2)ccn1 |
| InChI | InChI=1S/C23H18ClF3N4O5/c1-28-20(32)18-11-15(8-9-29-18)36-14-5-2-12(3-6-14)19(21(33)34)31-22(35)30-13-4-7-17(24)16(10-13)23(25,26)27/h2-11,19H,1H3,(H,28,32)(H,33,34)(H2,30,31,35)/p+1 |
| InChIKey | WUHFNQBFPDVMGT-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|