C23H20ClF3N4O3 — CID 135213694
ethyl N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamimidate (PubChem CID 135213694) has the molecular formula C23H20ClF3N4O3 and a molecular weight of 492.89 g/mol. Its IUPAC name is ethyl N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamimidate.
| Compound Name | ethyl N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamimidate |
|---|---|
| PubChem CID | 135213694 |
| Molecular Formula | C23H20ClF3N4O3 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | ethyl N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamimidate |
| SMILES | CCO/C(=N\c1ccc(Oc2ccnc(C(=O)NC)c2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20ClF3N4O3/c1-3-33-22(31-15-6-9-19(24)18(12-15)23(25,26)27)30-14-4-7-16(8-5-14)34-17-10-11-29-20(13-17)21(32)28-2/h4-13H,3H2,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | BBMYRRVRGJOZHI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|