C21H17ClF4N4O2 — CID 161220233
4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 161220233) has the molecular formula C21H17ClF4N4O2 and a molecular weight of 468.84 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 161220233 |
| Molecular Formula | C21H17ClF4N4O2 |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NCNc3ccc(Cl)c(C(F)(F)F)c3)c(F)c2)ccn1 |
| InChI | InChI=1S/C21H17ClF4N4O2/c1-27-20(31)19-10-14(6-7-28-19)32-13-3-5-18(17(23)9-13)30-11-29-12-2-4-16(22)15(8-12)21(24,25)26/h2-10,29-30H,11H2,1H3,(H,27,31) |
| InChIKey | UXKDGYBOYZJVJF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|