C21H19ClF4N4O3 — CID 161220232
4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide;hydrate (PubChem CID 161220232) has the molecular formula C21H19ClF4N4O3 and a molecular weight of 486.85 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide;hydrate.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide;hydrate |
|---|---|
| PubChem CID | 161220232 |
| Molecular Formula | C21H19ClF4N4O3 |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)anilino]methylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide;hydrate |
| SMILES | CNC(=O)c1cc(Oc2ccc(NCNc3ccc(Cl)c(C(F)(F)F)c3)c(F)c2)ccn1.O |
| InChI | InChI=1S/C21H17ClF4N4O2.H2O/c1-27-20(31)19-10-14(6-7-28-19)32-13-3-5-18(17(23)9-13)30-11-29-12-2-4-16(22)15(8-12)21(24,25)26;/h2-10,29-30H,11H2,1H3,(H,27,31);1H2 |
| InChIKey | HSYNKSVEDRZMDD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|