C26H24ClF3N4O2S — CID 71456721
4-[3-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-cyclohexylpyridine-2-carboxamide (PubChem CID 71456721) has the molecular formula C26H24ClF3N4O2S and a molecular weight of 549.02 g/mol. Its IUPAC name is 4-[3-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-cyclohexylpyridine-2-carboxamide.
| Compound Name | 4-[3-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-cyclohexylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 71456721 |
| Molecular Formula | C26H24ClF3N4O2S |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 4-[3-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-cyclohexylpyridine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(Oc2cccc(NC(=S)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C26H24ClF3N4O2S/c27-22-10-9-18(14-21(22)26(28,29)30)34-25(37)33-17-7-4-8-19(13-17)36-20-11-12-31-23(15-20)24(35)32-16-5-2-1-3-6-16/h4,7-16H,1-3,5-6H2,(H,32,35)(H2,33,34,37) |
| InChIKey | KVOBASSKLCWYLN-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|