C30H30ClF3N4O3 — CID 143262892
4-[3-[(E)-3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-(3-piperidin-1-ylpropyl)pyridine-2-carboxamide (PubChem CID 143262892) has the molecular formula C30H30ClF3N4O3 and a molecular weight of 587.04 g/mol. Its IUPAC name is 4-[3-[(E)-3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-(3-piperidin-1-ylpropyl)pyridine-2-carboxamide.
| Compound Name | 4-[3-[(E)-3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-(3-piperidin-1-ylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143262892 |
| Molecular Formula | C30H30ClF3N4O3 |
| Molecular Weight | 587.04 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 4-[3-[(E)-3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]-N-(3-piperidin-1-ylpropyl)pyridine-2-carboxamide |
| SMILES | O=C(/C=C/c1cccc(Oc2ccnc(C(=O)NCCCN3CCCCC3)c2)c1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H30ClF3N4O3/c31-26-10-9-22(19-25(26)30(32,33)34)37-28(39)11-8-21-6-4-7-23(18-21)41-24-12-14-35-27(20-24)29(40)36-13-5-17-38-15-2-1-3-16-38/h4,6-12,14,18-20H,1-3,5,13,15-17H2,(H,36,40)(H,37,39)/b11-8+ |
| InChIKey | FXOJRGYRHFWMHN-DHZHZOJOSA-N |
| XLogP | 6.80 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.04 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|