C25H23ClF3N5O3 — CID 22040431
4-[2-[4-chloro-3-(trifluoromethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide (PubChem CID 22040431) has the molecular formula C25H23ClF3N5O3 and a molecular weight of 533.94 g/mol. Its IUPAC name is 4-[2-[4-chloro-3-(trifluoromethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide.
| Compound Name | 4-[2-[4-chloro-3-(trifluoromethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22040431 |
| Molecular Formula | C25H23ClF3N5O3 |
| Molecular Weight | 533.94 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 4-[2-[4-chloro-3-(trifluoromethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide |
| SMILES | COCCCNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2ccc(Cl)c(C(F)(F)F)c2)n3C)ccn1 |
| InChI | InChI=1S/C25H23ClF3N5O3/c1-34-22-7-5-16(37-17-8-10-30-21(14-17)23(35)31-9-3-11-36-2)13-20(22)33-24(34)32-15-4-6-19(26)18(12-15)25(27,28)29/h4-8,10,12-14H,3,9,11H2,1-2H3,(H,31,35)(H,32,33) |
| InChIKey | WODURKOGFJJISJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.94 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|