C22H18ClF2N5O2 — CID 172943168
(NZ)-N-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 172943168) has the molecular formula C22H18ClF2N5O2 and a molecular weight of 457.87 g/mol. Its IUPAC name is (NZ)-N-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172943168 |
| Molecular Formula | C22H18ClF2N5O2 |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (NZ)-N-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)anilino]-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | Cn1c(Nc2ccc(Cl)c(C(C)(F)F)c2)nc2cc(Oc3ccnc(/C=N\O)c3)ccc21 |
| InChI | InChI=1S/C22H18ClF2N5O2/c1-22(24,25)17-10-13(3-5-18(17)23)28-21-29-19-11-15(4-6-20(19)30(21)2)32-16-7-8-26-14(9-16)12-27-31/h3-12,31H,1-2H3,(H,28,29)/b27-12- |
| InChIKey | LDYLNBHWZZMHGT-PPDIBHTLSA-N |
| XLogP | 6.08 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|