C21H15F3N4O2 — CID 91351416
4-[1-methyl-2-[4-(trifluoromethyl)anilino]benzimidazol-5-yl]oxypyridine-2-carbaldehyde (PubChem CID 91351416) has the molecular formula C21H15F3N4O2 and a molecular weight of 412.37 g/mol. Its IUPAC name is 4-[1-methyl-2-[4-(trifluoromethyl)anilino]benzimidazol-5-yl]oxypyridine-2-carbaldehyde.
| Compound Name | 4-[1-methyl-2-[4-(trifluoromethyl)anilino]benzimidazol-5-yl]oxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 91351416 |
| Molecular Formula | C21H15F3N4O2 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4-[1-methyl-2-[4-(trifluoromethyl)anilino]benzimidazol-5-yl]oxypyridine-2-carbaldehyde |
| SMILES | Cn1c(Nc2ccc(C(F)(F)F)cc2)nc2cc(Oc3ccnc(C=O)c3)ccc21 |
| InChI | InChI=1S/C21H15F3N4O2/c1-28-19-7-6-16(30-17-8-9-25-15(10-17)12-29)11-18(19)27-20(28)26-14-4-2-13(3-5-14)21(22,23)24/h2-12H,1H3,(H,26,27) |
| InChIKey | IEFPLYCVLMJULE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|