C20H16F3N3O2 — CID 143028784
4-[1-methyl-2-[(1Z,3E)-3-(trifluoromethyl)penta-1,3-dienyl]benzimidazol-5-yl]oxypyridine-2-carbaldehyde (PubChem CID 143028784) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 4-[1-methyl-2-[(1Z,3E)-3-(trifluoromethyl)penta-1,3-dienyl]benzimidazol-5-yl]oxypyridine-2-carbaldehyde.
| Compound Name | 4-[1-methyl-2-[(1Z,3E)-3-(trifluoromethyl)penta-1,3-dienyl]benzimidazol-5-yl]oxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 143028784 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-[1-methyl-2-[(1Z,3E)-3-(trifluoromethyl)penta-1,3-dienyl]benzimidazol-5-yl]oxypyridine-2-carbaldehyde |
| SMILES | C/C=C(\C=C/c1nc2cc(Oc3ccnc(C=O)c3)ccc2n1C)C(F)(F)F |
| InChI | InChI=1S/C20H16F3N3O2/c1-3-13(20(21,22)23)4-7-19-25-17-11-15(5-6-18(17)26(19)2)28-16-8-9-24-14(10-16)12-27/h3-12H,1-2H3/b7-4-,13-3+ |
| InChIKey | VKEFGMJOQFNWQO-TXPQKOLZSA-N |
| XLogP | 5.09 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|