C25H27N5O4 — CID 22040948
4-[2-(2-methoxyanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide (PubChem CID 22040948) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 4-[2-(2-methoxyanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide.
| Compound Name | 4-[2-(2-methoxyanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22040948 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 4-[2-(2-methoxyanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-methoxypropyl)pyridine-2-carboxamide |
| SMILES | COCCCNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2ccccc2OC)n3C)ccn1 |
| InChI | InChI=1S/C25H27N5O4/c1-30-22-10-9-17(15-20(22)29-25(30)28-19-7-4-5-8-23(19)33-3)34-18-11-13-26-21(16-18)24(31)27-12-6-14-32-2/h4-5,7-11,13,15-16H,6,12,14H2,1-3H3,(H,27,31)(H,28,29) |
| InChIKey | WBXMPGCPQNJVGF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|