C29H30F3N5O4 — CID 162135849
4-[1-methyl-2-[3-propan-2-yl-4-(trifluoromethoxy)anilino]benzimidazol-5-yl]oxy-N-(4-oxopentyl)pyridine-2-carboxamide (PubChem CID 162135849) has the molecular formula C29H30F3N5O4 and a molecular weight of 569.58 g/mol. Its IUPAC name is 4-[1-methyl-2-[3-propan-2-yl-4-(trifluoromethoxy)anilino]benzimidazol-5-yl]oxy-N-(4-oxopentyl)pyridine-2-carboxamide.
| Compound Name | 4-[1-methyl-2-[3-propan-2-yl-4-(trifluoromethoxy)anilino]benzimidazol-5-yl]oxy-N-(4-oxopentyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162135849 |
| Molecular Formula | C29H30F3N5O4 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 4-[1-methyl-2-[3-propan-2-yl-4-(trifluoromethoxy)anilino]benzimidazol-5-yl]oxy-N-(4-oxopentyl)pyridine-2-carboxamide |
| SMILES | CC(=O)CCCNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2ccc(OC(F)(F)F)c(C(C)C)c2)n3C)ccn1 |
| InChI | InChI=1S/C29H30F3N5O4/c1-17(2)22-14-19(7-10-26(22)41-29(30,31)32)35-28-36-23-15-20(8-9-25(23)37(28)4)40-21-11-13-33-24(16-21)27(39)34-12-5-6-18(3)38/h7-11,13-17H,5-6,12H2,1-4H3,(H,34,39)(H,35,36) |
| InChIKey | ZJGRBAPPALVDLR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|