C31H36FN5O4S — CID 160504403
4-[2-(3-cyclopentyl-4-fluoroanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-propan-2-ylsulfonylpropyl)pyridine-2-carboxamide (PubChem CID 160504403) has the molecular formula C31H36FN5O4S and a molecular weight of 593.73 g/mol. Its IUPAC name is 4-[2-(3-cyclopentyl-4-fluoroanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-propan-2-ylsulfonylpropyl)pyridine-2-carboxamide.
| Compound Name | 4-[2-(3-cyclopentyl-4-fluoroanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-propan-2-ylsulfonylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 160504403 |
| Molecular Formula | C31H36FN5O4S |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | 4-[2-(3-cyclopentyl-4-fluoroanilino)-1-methylbenzimidazol-5-yl]oxy-N-(3-propan-2-ylsulfonylpropyl)pyridine-2-carboxamide |
| SMILES | CC(C)S(=O)(=O)CCCNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2ccc(F)c(C4CCCC4)c2)n3C)ccn1 |
| InChI | InChI=1S/C31H36FN5O4S/c1-20(2)42(39,40)16-6-14-34-30(38)28-19-24(13-15-33-28)41-23-10-12-29-27(18-23)36-31(37(29)3)35-22-9-11-26(32)25(17-22)21-7-4-5-8-21/h9-13,15,17-21H,4-8,14,16H2,1-3H3,(H,34,38)(H,35,36) |
| InChIKey | QSEWKKVKSQGNBL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|