C28H31N5O2 — CID 22041074
4-[2-(3-cycloheptylanilino)-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide (PubChem CID 22041074) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 4-[2-(3-cycloheptylanilino)-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[2-(3-cycloheptylanilino)-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 22041074 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 4-[2-(3-cycloheptylanilino)-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2cccc(C4CCCCCC4)c2)n3C)ccn1 |
| InChI | InChI=1S/C28H31N5O2/c1-29-27(34)25-18-23(14-15-30-25)35-22-12-13-26-24(17-22)32-28(33(26)2)31-21-11-7-10-20(16-21)19-8-5-3-4-6-9-19/h7,10-19H,3-6,8-9H2,1-2H3,(H,29,34)(H,31,32) |
| InChIKey | OOGBXHDJRCXFGS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |