C27H22N6O5 — CID 22040422
N-methyl-4-[1-methyl-2-[4-(4-nitrophenoxy)anilino]benzimidazol-5-yl]oxypyridine-2-carboxamide (PubChem CID 22040422) has the molecular formula C27H22N6O5 and a molecular weight of 510.51 g/mol. Its IUPAC name is N-methyl-4-[1-methyl-2-[4-(4-nitrophenoxy)anilino]benzimidazol-5-yl]oxypyridine-2-carboxamide.
| Compound Name | N-methyl-4-[1-methyl-2-[4-(4-nitrophenoxy)anilino]benzimidazol-5-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 22040422 |
| Molecular Formula | C27H22N6O5 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | N-methyl-4-[1-methyl-2-[4-(4-nitrophenoxy)anilino]benzimidazol-5-yl]oxypyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2ccc(Oc4ccc([N+](=O)[O-])cc4)cc2)n3C)ccn1 |
| InChI | InChI=1S/C27H22N6O5/c1-28-26(34)24-16-22(13-14-29-24)38-21-11-12-25-23(15-21)31-27(32(25)2)30-17-3-7-19(8-4-17)37-20-9-5-18(6-10-20)33(35)36/h3-16H,1-2H3,(H,28,34)(H,30,31) |
| InChIKey | BXADLTWVDSEBGM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|