C25H21N5O3 — CID 22040449
4-[2-[3-(furan-3-yl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide (PubChem CID 22040449) has the molecular formula C25H21N5O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 4-[2-[3-(furan-3-yl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[2-[3-(furan-3-yl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 22040449 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-[2-[3-(furan-3-yl)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2cccc(-c4ccoc4)c2)n3C)ccn1 |
| InChI | InChI=1S/C25H21N5O3/c1-26-24(31)22-14-20(8-10-27-22)33-19-6-7-23-21(13-19)29-25(30(23)2)28-18-5-3-4-16(12-18)17-9-11-32-15-17/h3-15H,1-2H3,(H,26,31)(H,28,29) |
| InChIKey | JGCKXGFPYSAZLI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |