C23H24N6O2 — CID 21037270
4-[2-[4-(dimethylamino)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide (PubChem CID 21037270) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-[2-[4-(dimethylamino)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[2-[4-(dimethylamino)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 21037270 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-[2-[4-(dimethylamino)anilino]-1-methylbenzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3c(c2)nc(Nc2ccc(N(C)C)cc2)n3C)ccn1 |
| InChI | InChI=1S/C23H24N6O2/c1-24-22(30)20-14-18(11-12-25-20)31-17-9-10-21-19(13-17)27-23(29(21)4)26-15-5-7-16(8-6-15)28(2)3/h5-14H,1-4H3,(H,24,30)(H,26,27) |
| InChIKey | WDWZTHMTOHDINU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|