C25H26BrN5O4 — CID 22040932
4-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxy-N-(2-methoxyethyl)pyridine-2-carboxamide (PubChem CID 22040932) has the molecular formula C25H26BrN5O4 and a molecular weight of 540.42 g/mol. Its IUPAC name is 4-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxy-N-(2-methoxyethyl)pyridine-2-carboxamide.
| Compound Name | 4-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxy-N-(2-methoxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22040932 |
| Molecular Formula | C25H26BrN5O4 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 4-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxy-N-(2-methoxyethyl)pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1cc(Oc2cc3nc(Nc4ccc(Br)c(C)c4)n(C)c3cc2OC)ccn1 |
| InChI | InChI=1S/C25H26BrN5O4/c1-15-11-16(5-6-18(15)26)29-25-30-19-13-23(22(34-4)14-21(19)31(25)2)35-17-7-8-27-20(12-17)24(32)28-9-10-33-3/h5-8,11-14H,9-10H2,1-4H3,(H,28,32)(H,29,30) |
| InChIKey | AIGBBPDBDCLPOY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|