C28H27ClF3N3O5 — CID 11505171
ethyl 4-[[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyridine-2-carbonyl]amino]butanoate (PubChem CID 11505171) has the molecular formula C28H27ClF3N3O5 and a molecular weight of 577.99 g/mol. Its IUPAC name is ethyl 4-[[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyridine-2-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyridine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11505171 |
| Molecular Formula | C28H27ClF3N3O5 |
| Molecular Weight | 577.99 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | ethyl 4-[[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyridine-2-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1cc(Oc2cccc(CCC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C28H27ClF3N3O5/c1-2-39-26(37)7-4-13-34-27(38)24-17-21(12-14-33-24)40-20-6-3-5-18(15-20)8-11-25(36)35-19-9-10-23(29)22(16-19)28(30,31)32/h3,5-6,9-10,12,14-17H,2,4,7-8,11,13H2,1H3,(H,34,38)(H,35,36) |
| InChIKey | KVBSXRJVMCVTMY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.99 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|