C22H19ClF3N4O3- — CID 163922153
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(2-methyl-2-oxidohydrazinyl)-4-pyridinyl]oxy]phenyl]propanamide (PubChem CID 163922153) has the molecular formula C22H19ClF3N4O3- and a molecular weight of 479.87 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(2-methyl-2-oxidohydrazinyl)-4-pyridinyl]oxy]phenyl]propanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(2-methyl-2-oxidohydrazinyl)-4-pyridinyl]oxy]phenyl]propanamide |
|---|---|
| PubChem CID | 163922153 |
| Molecular Formula | C22H19ClF3N4O3- |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(2-methyl-2-oxidohydrazinyl)-4-pyridinyl]oxy]phenyl]propanamide |
| SMILES | CN([O-])Nc1cc(Oc2cccc(CCC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C22H19ClF3N4O3/c1-30(32)29-20-13-17(9-10-27-20)33-16-4-2-3-14(11-16)5-8-21(31)28-15-6-7-19(23)18(12-15)22(24,25)26/h2-4,6-7,9-13H,5,8H2,1H3,(H,27,29)(H,28,31)/q-1 |
| InChIKey | GSFBCAYSOIYPCO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|