C22H18ClF3N6O2 — CID 171927080
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(N'-diazenylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]propanamide (PubChem CID 171927080) has the molecular formula C22H18ClF3N6O2 and a molecular weight of 490.87 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(N'-diazenylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]propanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(N'-diazenylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]propanamide |
|---|---|
| PubChem CID | 171927080 |
| Molecular Formula | C22H18ClF3N6O2 |
| Molecular Weight | 490.87 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[2-(N'-diazenylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]propanamide |
| SMILES | [H]/N=N/N=C(N)c1cc(Oc2cccc(CCC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C22H18ClF3N6O2/c23-18-6-5-14(11-17(18)22(24,25)26)30-20(33)7-4-13-2-1-3-15(10-13)34-16-8-9-29-19(12-16)21(27)31-32-28/h1-3,5-6,8-12H,4,7H2,(H,30,33)(H3,27,28,31) |
| InChIKey | MLZSPOGRXKXXHG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.87 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|