C24H22ClF3N4O2 — CID 58674463
3-[3-[[2-[(1-aminoethylideneamino)methyl]-4-pyridinyl]oxy]phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 58674463) has the molecular formula C24H22ClF3N4O2 and a molecular weight of 490.91 g/mol. Its IUPAC name is 3-[3-[[2-[(1-aminoethylideneamino)methyl]-4-pyridinyl]oxy]phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[3-[[2-[(1-aminoethylideneamino)methyl]-4-pyridinyl]oxy]phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 58674463 |
| Molecular Formula | C24H22ClF3N4O2 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 3-[3-[[2-[(1-aminoethylideneamino)methyl]-4-pyridinyl]oxy]phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C/C(N)=N\Cc1cc(Oc2cccc(CCC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C24H22ClF3N4O2/c1-15(29)31-14-18-12-20(9-10-30-18)34-19-4-2-3-16(11-19)5-8-23(33)32-17-6-7-22(25)21(13-17)24(26,27)28/h2-4,6-7,9-13H,5,8,14H2,1H3,(H2,29,31)(H,32,33) |
| InChIKey | FDRRGURATCVLNT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|