C15H18ClF3N2S — CID 100601519
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cycloheptylthiourea (PubChem CID 100601519) has the molecular formula C15H18ClF3N2S and a molecular weight of 350.84 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cycloheptylthiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cycloheptylthiourea |
|---|---|
| PubChem CID | 100601519 |
| Molecular Formula | C15H18ClF3N2S |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cycloheptylthiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)NC2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C15H18ClF3N2S/c16-13-8-7-11(9-12(13)15(17,18)19)21-14(22)20-10-5-3-1-2-4-6-10/h7-10H,1-6H2,(H2,20,21,22) |
| InChIKey | DANZXEVVLWMYIK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|