C24H22ClF3N4OS2 — CID 174656264
N-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide (PubChem CID 174656264) has the molecular formula C24H22ClF3N4OS2 and a molecular weight of 539.05 g/mol. Its IUPAC name is N-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174656264 |
| Molecular Formula | C24H22ClF3N4OS2 |
| Molecular Weight | 539.05 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | N-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCC(c2cc(NC(=S)Nc3ccc(Cl)c(C(F)(F)F)c3)cs2)CC1)c1ccccn1 |
| InChI | InChI=1S/C24H22ClF3N4OS2/c25-19-9-8-16(11-18(19)24(26,27)28)31-23(34)32-17-12-21(35-13-17)14-4-6-15(7-5-14)30-22(33)20-3-1-2-10-29-20/h1-3,8-15H,4-7H2,(H,30,33)(H2,31,32,34) |
| InChIKey | VBDVLOIZZYDHNL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.05 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|