C18H19F3N4OS2 — CID 174667925
N-[4-[4-(trifluoromethylcarbamothioylamino)thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide (PubChem CID 174667925) has the molecular formula C18H19F3N4OS2 and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[4-[4-(trifluoromethylcarbamothioylamino)thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-(trifluoromethylcarbamothioylamino)thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174667925 |
| Molecular Formula | C18H19F3N4OS2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[4-[4-(trifluoromethylcarbamothioylamino)thiophen-2-yl]cyclohexyl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCC(c2cc(NC(=S)NC(F)(F)F)cs2)CC1)c1ccccn1 |
| InChI | InChI=1S/C18H19F3N4OS2/c19-18(20,21)25-17(27)24-13-9-15(28-10-13)11-4-6-12(7-5-11)23-16(26)14-3-1-2-8-22-14/h1-3,8-12H,4-7H2,(H,23,26)(H2,24,25,27) |
| InChIKey | AIRTWPCCCIXVBE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|