C23H19F3N4OS2 — CID 71482620
N-cyclopropyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]sulfanylpyridine-2-carboxamide (PubChem CID 71482620) has the molecular formula C23H19F3N4OS2 and a molecular weight of 488.56 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]sulfanylpyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]sulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 71482620 |
| Molecular Formula | C23H19F3N4OS2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-cyclopropyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]sulfanylpyridine-2-carboxamide |
| SMILES | O=C(NC1CC1)c1cc(Sc2ccc(NC(=S)Nc3cccc(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C23H19F3N4OS2/c24-23(25,26)14-2-1-3-17(12-14)30-22(32)29-16-6-8-18(9-7-16)33-19-10-11-27-20(13-19)21(31)28-15-4-5-15/h1-3,6-13,15H,4-5H2,(H,28,31)(H2,29,30,32) |
| InChIKey | XXHXZRDHOSPKNH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|