C20H20F3N3O2 — CID 109081616
2-N-cyclohexyl-4-N-[4-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide (PubChem CID 109081616) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-[4-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-cyclohexyl-4-N-[4-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081616 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-N-cyclohexyl-4-N-[4-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccnc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C20H20F3N3O2/c21-20(22,23)14-6-8-16(9-7-14)25-18(27)13-10-11-24-17(12-13)19(28)26-15-4-2-1-3-5-15/h6-12,15H,1-5H2,(H,25,27)(H,26,28) |
| InChIKey | WGWCDUROSGVWQS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |