C21H25N3O4 — CID 109081613
2-N-cyclohexyl-4-N-(3,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109081613) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-(3,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-cyclohexyl-4-N-(3,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081613 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-N-cyclohexyl-4-N-(3,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2ccnc(C(=O)NC3CCCCC3)c2)cc1OC |
| InChI | InChI=1S/C21H25N3O4/c1-27-18-9-8-16(13-19(18)28-2)24-20(25)14-10-11-22-17(12-14)21(26)23-15-6-4-3-5-7-15/h8-13,15H,3-7H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | VPQQSIPOGRWPBZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |