C20H22F3N3O — CID 109217173
4-(cycloheptylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide (PubChem CID 109217173) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is 4-(cycloheptylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide.
| Compound Name | 4-(cycloheptylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109217173 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-(cycloheptylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cc(NC2CCCCCC2)ccn1 |
| InChI | InChI=1S/C20H22F3N3O/c21-20(22,23)14-7-9-16(10-8-14)26-19(27)18-13-17(11-12-24-18)25-15-5-3-1-2-4-6-15/h7-13,15H,1-6H2,(H,24,25)(H,26,27) |
| InChIKey | ULKNGGYZWOONRF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |