C22H17F3N4O4 — CID 11408487
N'-[3-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 11408487) has the molecular formula C22H17F3N4O4 and a molecular weight of 458.40 g/mol. Its IUPAC name is N'-[3-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[3-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 11408487 |
| Molecular Formula | C22H17F3N4O4 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N'-[3-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(NC(=O)C(=O)Nc3ccc(C(F)(F)F)cc3)c2)ccn1 |
| InChI | InChI=1S/C22H17F3N4O4/c1-26-19(30)18-12-17(9-10-27-18)33-16-4-2-3-15(11-16)29-21(32)20(31)28-14-7-5-13(6-8-14)22(23,24)25/h2-12H,1H3,(H,26,30)(H,28,31)(H,29,32) |
| InChIKey | DQRPYHDVRDFJDM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|