C24H24F3N5O4 — CID 58919866
N-methyl-4-[3-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide (PubChem CID 58919866) has the molecular formula C24H24F3N5O4 and a molecular weight of 503.48 g/mol. Its IUPAC name is N-methyl-4-[3-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[3-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58919866 |
| Molecular Formula | C24H24F3N5O4 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N-methyl-4-[3-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide |
| SMILES | CNCCOc1ccc(C(F)(F)F)cc1NC(=O)Nc1cccc(Oc2ccnc(C(=O)NC)c2)c1 |
| InChI | InChI=1S/C24H24F3N5O4/c1-28-10-11-35-21-7-6-15(24(25,26)27)12-19(21)32-23(34)31-16-4-3-5-17(13-16)36-18-8-9-30-20(14-18)22(33)29-2/h3-9,12-14,28H,10-11H2,1-2H3,(H,29,33)(H2,31,32,34) |
| InChIKey | LTVGWDJOEQTYDG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|