C22H17F5N4O3 — CID 131953278
N-methyl-4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide (PubChem CID 131953278) has the molecular formula C22H17F5N4O3 and a molecular weight of 480.39 g/mol. Its IUPAC name is N-methyl-4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 131953278 |
| Molecular Formula | C22H17F5N4O3 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-methyl-4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3cccc(C(F)(F)C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C22H17F5N4O3/c1-28-19(32)18-12-17(9-10-29-18)34-16-7-5-14(6-8-16)30-20(33)31-15-4-2-3-13(11-15)21(23,24)22(25,26)27/h2-12H,1H3,(H,28,32)(H2,30,31,33) |
| InChIKey | RGXLJFYUVULPOX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|