C20H16F3N3O4S — CID 70682282
N-methyl-4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]pyridine-2-carboxamide (PubChem CID 70682282) has the molecular formula C20H16F3N3O4S and a molecular weight of 451.43 g/mol. Its IUPAC name is N-methyl-4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70682282 |
| Molecular Formula | C20H16F3N3O4S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-methyl-4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(NS(=O)(=O)c3cccc(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C20H16F3N3O4S/c1-24-19(27)18-12-16(8-9-25-18)30-15-6-3-5-14(11-15)26-31(28,29)17-7-2-4-13(10-17)20(21,22)23/h2-12,26H,1H3,(H,24,27) |
| InChIKey | GYYAEVTZBPXDBI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |