C23H19AsF3N2O3 — CID 87621408
CID 87621408 (PubChem CID 87621408) has the molecular formula C23H19AsF3N2O3 and a molecular weight of 503.33 g/mol.
| Compound Name | CID 87621408 |
|---|---|
| PubChem CID | 87621408 |
| Molecular Formula | C23H19AsF3N2O3 |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1cc(Oc2cccc(CC[As]C(=O)c3cccc(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C23H19AsF3N2O3/c1-28-22(31)20-14-19(9-11-29-20)32-18-7-2-4-15(12-18)8-10-24-21(30)16-5-3-6-17(13-16)23(25,26)27/h2-7,9,11-14H,8,10H2,1H3,(H,28,31) |
| InChIKey | CKNMIGIMYMEDHB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|