C22H20ClN3O3 — CID 25051719
4-[3-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 25051719) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 4-[3-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 25051719 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 4-[3-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(CCNC(=O)c3ccc(Cl)cc3)c2)ccn1 |
| InChI | InChI=1S/C22H20ClN3O3/c1-24-22(28)20-14-19(10-12-25-20)29-18-4-2-3-15(13-18)9-11-26-21(27)16-5-7-17(23)8-6-16/h2-8,10,12-14H,9,11H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | YPQXANHGUCOGQG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |