C26H30N4O3 — CID 25051717
4-[3-[2-[[4-(diethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 25051717) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 4-[3-[2-[[4-(diethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[2-[[4-(diethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 25051717 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4-[3-[2-[[4-(diethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(C(=O)NCCc2cccc(Oc3ccnc(C(=O)NC)c3)c2)cc1 |
| InChI | InChI=1S/C26H30N4O3/c1-4-30(5-2)21-11-9-20(10-12-21)25(31)29-15-13-19-7-6-8-22(17-19)33-23-14-16-28-24(18-23)26(32)27-3/h6-12,14,16-18H,4-5,13,15H2,1-3H3,(H,27,32)(H,29,31) |
| InChIKey | RDVARKMYCUZNLV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |