C24H26N4O3 — CID 25051896
4-[3-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 25051896) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-[3-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 25051896 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-[3-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(CCNC(=O)c3ccc(N(C)C)cc3)c2)ccn1 |
| InChI | InChI=1S/C24H26N4O3/c1-25-24(30)22-16-21(12-14-26-22)31-20-6-4-5-17(15-20)11-13-27-23(29)18-7-9-19(10-8-18)28(2)3/h4-10,12,14-16H,11,13H2,1-3H3,(H,25,30)(H,27,29) |
| InChIKey | PEZWRNRBFGUNHA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |