C25H27N3O3 — CID 160705084
4-[4-[4-[3-(dimethylamino)phenyl]-3-oxobutyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 160705084) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[4-[4-[3-(dimethylamino)phenyl]-3-oxobutyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[4-[3-(dimethylamino)phenyl]-3-oxobutyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 160705084 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[4-[4-[3-(dimethylamino)phenyl]-3-oxobutyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(CCC(=O)Cc3cccc(N(C)C)c3)cc2)ccn1 |
| InChI | InChI=1S/C25H27N3O3/c1-26-25(30)24-17-23(13-14-27-24)31-22-11-8-18(9-12-22)7-10-21(29)16-19-5-4-6-20(15-19)28(2)3/h4-6,8-9,11-15,17H,7,10,16H2,1-3H3,(H,26,30) |
| InChIKey | RRCSULOZWMLQGG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |