C32H35N3O3 — CID 160887850
4-[4-[3-[5-tert-butyl-2-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxopropyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 160887850) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-[4-[3-[5-tert-butyl-2-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxopropyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[3-[5-tert-butyl-2-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxopropyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 160887850 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 4-[4-[3-[5-tert-butyl-2-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxopropyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(CC(=O)Cc3cc(C(C)(C)C)ccc3-n3c(C)ccc3C)cc2)ccn1 |
| InChI | InChI=1S/C32H35N3O3/c1-21-7-8-22(2)35(21)30-14-11-25(32(3,4)5)18-24(30)19-26(36)17-23-9-12-27(13-10-23)38-28-15-16-34-29(20-28)31(37)33-6/h7-16,18,20H,17,19H2,1-6H3,(H,33,37) |
| InChIKey | SNWJYEMIEWOZJS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|