C29H24N4O3S — CID 59685030
4-[3-[2-[[2-(2-isocyanophenyl)sulfanylbenzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 59685030) has the molecular formula C29H24N4O3S and a molecular weight of 508.60 g/mol. Its IUPAC name is 4-[3-[2-[[2-(2-isocyanophenyl)sulfanylbenzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[2-[[2-(2-isocyanophenyl)sulfanylbenzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 59685030 |
| Molecular Formula | C29H24N4O3S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 4-[3-[2-[[2-(2-isocyanophenyl)sulfanylbenzoyl]amino]ethyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | [C-]#[N+]c1ccccc1Sc1ccccc1C(=O)NCCc1cccc(Oc2ccnc(C(=O)NC)c2)c1 |
| InChI | InChI=1S/C29H24N4O3S/c1-30-24-11-4-6-13-27(24)37-26-12-5-3-10-23(26)28(34)33-16-14-20-8-7-9-21(18-20)36-22-15-17-32-25(19-22)29(35)31-2/h3-13,15,17-19H,14,16H2,2H3,(H,31,35)(H,33,34) |
| InChIKey | YKKZVPHSYSMICU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 84.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|