C24H25N3O3S — CID 89291718
N-methyl-4-[3-[2-[[4-(1-sulfanylethyl)benzoyl]amino]ethyl]phenoxy]pyridine-2-carboxamide (PubChem CID 89291718) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-methyl-4-[3-[2-[[4-(1-sulfanylethyl)benzoyl]amino]ethyl]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[3-[2-[[4-(1-sulfanylethyl)benzoyl]amino]ethyl]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89291718 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-methyl-4-[3-[2-[[4-(1-sulfanylethyl)benzoyl]amino]ethyl]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(CCNC(=O)c3ccc(C(C)S)cc3)c2)ccn1 |
| InChI | InChI=1S/C24H25N3O3S/c1-16(31)18-6-8-19(9-7-18)23(28)27-12-10-17-4-3-5-20(14-17)30-21-11-13-26-22(15-21)24(29)25-2/h3-9,11,13-16,31H,10,12H2,1-2H3,(H,25,29)(H,27,28) |
| InChIKey | CLUPZZNIYZVNEM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|