C24H22ClF3N4O2 — CID 59685045
4-chloro-N-[2-[3-[[2-(N,N'-dimethylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 59685045) has the molecular formula C24H22ClF3N4O2 and a molecular weight of 490.91 g/mol. Its IUPAC name is 4-chloro-N-[2-[3-[[2-(N,N'-dimethylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-chloro-N-[2-[3-[[2-(N,N'-dimethylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59685045 |
| Molecular Formula | C24H22ClF3N4O2 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-chloro-N-[2-[3-[[2-(N,N'-dimethylcarbamimidoyl)-4-pyridinyl]oxy]phenyl]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | C/N=C(\NC)c1cc(Oc2cccc(CCNC(=O)c3ccc(Cl)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C24H22ClF3N4O2/c1-29-22(30-2)21-14-18(9-11-31-21)34-17-5-3-4-15(12-17)8-10-32-23(33)16-6-7-20(25)19(13-16)24(26,27)28/h3-7,9,11-14H,8,10H2,1-2H3,(H,29,30)(H,32,33) |
| InChIKey | QQGDYFSYYAYFAZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|